C25H25N3O3 — CID 5174295
1-(2,4-dimethylphenyl)-3-[4-(2-methoxyanilino)anilino]pyrrolidine-2,5-dione (PubChem CID 5174295) has the molecular formula C25H25N3O3 and a molecular weight of 415.49 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-3-[4-(2-methoxyanilino)anilino]pyrrolidine-2,5-dione.
| Compound Name | 1-(2,4-dimethylphenyl)-3-[4-(2-methoxyanilino)anilino]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 5174295 |
| Molecular Formula | C25H25N3O3 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-3-[4-(2-methoxyanilino)anilino]pyrrolidine-2,5-dione |
| SMILES | COc1ccccc1Nc1ccc(NC2CC(=O)N(c3ccc(C)cc3C)C2=O)cc1 |
| InChI | InChI=1S/C25H25N3O3/c1-16-8-13-22(17(2)14-16)28-24(29)15-21(25(28)30)27-19-11-9-18(10-12-19)26-20-6-4-5-7-23(20)31-3/h4-14,21,26-27H,15H2,1-3H3 |
| InChIKey | WSUYXZJFXBPIKL-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|