C26H25N3O4 — CID 2427402
4-[[(3S)-1-(2,4-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]amino]-N-(4-methoxyphenyl)benzamide (PubChem CID 2427402) has the molecular formula C26H25N3O4 and a molecular weight of 443.50 g/mol. Its IUPAC name is 4-[[(3S)-1-(2,4-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]amino]-N-(4-methoxyphenyl)benzamide.
| Compound Name | 4-[[(3S)-1-(2,4-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]amino]-N-(4-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 2427402 |
| Molecular Formula | C26H25N3O4 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 4-[[(3S)-1-(2,4-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]amino]-N-(4-methoxyphenyl)benzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(N[C@H]3CC(=O)N(c4ccc(C)cc4C)C3=O)cc2)cc1 |
| InChI | InChI=1S/C26H25N3O4/c1-16-4-13-23(17(2)14-16)29-24(30)15-22(26(29)32)27-19-7-5-18(6-8-19)25(31)28-20-9-11-21(33-3)12-10-20/h4-14,22,27H,15H2,1-3H3,(H,28,31)/t22-/m0/s1 |
| InChIKey | ZFIHGLUOHNUYEX-QFIPXVFZSA-N |
| XLogP | 4.31 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|