C20H19N3O2 — CID 124560433
(3R)-1-(2,4-dimethylphenyl)-3-(1H-indol-6-ylamino)pyrrolidine-2,5-dione (PubChem CID 124560433) has the molecular formula C20H19N3O2 and a molecular weight of 333.39 g/mol. Its IUPAC name is (3R)-1-(2,4-dimethylphenyl)-3-(1H-indol-6-ylamino)pyrrolidine-2,5-dione.
| Compound Name | (3R)-1-(2,4-dimethylphenyl)-3-(1H-indol-6-ylamino)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 124560433 |
| Molecular Formula | C20H19N3O2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | (3R)-1-(2,4-dimethylphenyl)-3-(1H-indol-6-ylamino)pyrrolidine-2,5-dione |
| SMILES | Cc1ccc(N2C(=O)C[C@@H](Nc3ccc4cc[nH]c4c3)C2=O)c(C)c1 |
| InChI | InChI=1S/C20H19N3O2/c1-12-3-6-18(13(2)9-12)23-19(24)11-17(20(23)25)22-15-5-4-14-7-8-21-16(14)10-15/h3-10,17,21-22H,11H2,1-2H3/t17-/m1/s1 |
| InChIKey | SPQUZIPVRIPOOA-QGZVFWFLSA-N |
| XLogP | 3.53 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|