C18H15N3O2 — CID 19057923
3-(1H-indol-6-ylamino)-1-phenylpyrrolidine-2,5-dione (PubChem CID 19057923) has the molecular formula C18H15N3O2 and a molecular weight of 305.34 g/mol. Its IUPAC name is 3-(1H-indol-6-ylamino)-1-phenylpyrrolidine-2,5-dione.
| Compound Name | 3-(1H-indol-6-ylamino)-1-phenylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 19057923 |
| Molecular Formula | C18H15N3O2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 3-(1H-indol-6-ylamino)-1-phenylpyrrolidine-2,5-dione |
| SMILES | O=C1CC(Nc2ccc3cc[nH]c3c2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C18H15N3O2/c22-17-11-16(18(23)21(17)14-4-2-1-3-5-14)20-13-7-6-12-8-9-19-15(12)10-13/h1-10,16,19-20H,11H2 |
| InChIKey | ZQWIRLWROICUIX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|