C24H26N4O2 — CID 19058082
3-[(1-benzylpiperidin-4-yl)amino]-1-(1H-indol-6-yl)pyrrolidine-2,5-dione (PubChem CID 19058082) has the molecular formula C24H26N4O2 and a molecular weight of 402.50 g/mol. Its IUPAC name is 3-[(1-benzylpiperidin-4-yl)amino]-1-(1H-indol-6-yl)pyrrolidine-2,5-dione.
| Compound Name | 3-[(1-benzylpiperidin-4-yl)amino]-1-(1H-indol-6-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 19058082 |
| Molecular Formula | C24H26N4O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 3-[(1-benzylpiperidin-4-yl)amino]-1-(1H-indol-6-yl)pyrrolidine-2,5-dione |
| SMILES | O=C1CC(NC2CCN(Cc3ccccc3)CC2)C(=O)N1c1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C24H26N4O2/c29-23-15-22(24(30)28(23)20-7-6-18-8-11-25-21(18)14-20)26-19-9-12-27(13-10-19)16-17-4-2-1-3-5-17/h1-8,11,14,19,22,25-26H,9-10,12-13,15-16H2 |
| InChIKey | IRCNXTDFJLUJDY-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|