C15H15N3O2 — CID 19058066
1-(1H-indol-6-yl)-3-(prop-2-enylamino)pyrrolidine-2,5-dione (PubChem CID 19058066) has the molecular formula C15H15N3O2 and a molecular weight of 269.30 g/mol. Its IUPAC name is 1-(1H-indol-6-yl)-3-(prop-2-enylamino)pyrrolidine-2,5-dione.
| Compound Name | 1-(1H-indol-6-yl)-3-(prop-2-enylamino)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 19058066 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 1-(1H-indol-6-yl)-3-(prop-2-enylamino)pyrrolidine-2,5-dione |
| SMILES | C=CCNC1CC(=O)N(c2ccc3cc[nH]c3c2)C1=O |
| InChI | InChI=1S/C15H15N3O2/c1-2-6-16-13-9-14(19)18(15(13)20)11-4-3-10-5-7-17-12(10)8-11/h2-5,7-8,13,16-17H,1,6,9H2 |
| InChIKey | FSEJOQGYEHVLIB-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|