C22H19FN2O5 — CID 22775595
[2-(4-fluorophenyl)-2-oxoethyl] 4-[2,5-dioxo-3-(prop-2-enylamino)pyrrolidin-1-yl]benzoate (PubChem CID 22775595) has the molecular formula C22H19FN2O5 and a molecular weight of 410.40 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-2-oxoethyl] 4-[2,5-dioxo-3-(prop-2-enylamino)pyrrolidin-1-yl]benzoate.
| Compound Name | [2-(4-fluorophenyl)-2-oxoethyl] 4-[2,5-dioxo-3-(prop-2-enylamino)pyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 22775595 |
| Molecular Formula | C22H19FN2O5 |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | [2-(4-fluorophenyl)-2-oxoethyl] 4-[2,5-dioxo-3-(prop-2-enylamino)pyrrolidin-1-yl]benzoate |
| SMILES | C=CCNC1CC(=O)N(c2ccc(C(=O)OCC(=O)c3ccc(F)cc3)cc2)C1=O |
| InChI | InChI=1S/C22H19FN2O5/c1-2-11-24-18-12-20(27)25(21(18)28)17-9-5-15(6-10-17)22(29)30-13-19(26)14-3-7-16(23)8-4-14/h2-10,18,24H,1,11-13H2 |
| InChIKey | VIHSVJGARLYHKB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|