C17H22N2O2 — CID 155114952
1-benzyl-3-(cyclohexylamino)pyrrolidine-2,5-dione (PubChem CID 155114952) has the molecular formula C17H22N2O2 and a molecular weight of 286.37 g/mol. Its IUPAC name is 1-benzyl-3-(cyclohexylamino)pyrrolidine-2,5-dione.
| Compound Name | 1-benzyl-3-(cyclohexylamino)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 155114952 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 1-benzyl-3-(cyclohexylamino)pyrrolidine-2,5-dione |
| SMILES | O=C1CC(NC2CCCCC2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C17H22N2O2/c20-16-11-15(18-14-9-5-2-6-10-14)17(21)19(16)12-13-7-3-1-4-8-13/h1,3-4,7-8,14-15,18H,2,5-6,9-12H2 |
| InChIKey | MGLZVSMKWUUFBD-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|