C25H29N3O2 — CID 98708459
(3R)-3-[(1-benzylpiperidin-4-yl)amino]-1-(2,3-dihydro-1H-inden-5-yl)pyrrolidine-2,5-dione (PubChem CID 98708459) has the molecular formula C25H29N3O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is (3R)-3-[(1-benzylpiperidin-4-yl)amino]-1-(2,3-dihydro-1H-inden-5-yl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[(1-benzylpiperidin-4-yl)amino]-1-(2,3-dihydro-1H-inden-5-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 98708459 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | (3R)-3-[(1-benzylpiperidin-4-yl)amino]-1-(2,3-dihydro-1H-inden-5-yl)pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@@H](NC2CCN(Cc3ccccc3)CC2)C(=O)N1c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C25H29N3O2/c29-24-16-23(25(30)28(24)22-10-9-19-7-4-8-20(19)15-22)26-21-11-13-27(14-12-21)17-18-5-2-1-3-6-18/h1-3,5-6,9-10,15,21,23,26H,4,7-8,11-14,16-17H2/t23-/m1/s1 |
| InChIKey | KPBPIEZHOVINQQ-HSZRJFAPSA-N |
| XLogP | 3.06 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|