C16H13FN2O2 — CID 43410376
3-(3-fluoroanilino)-1-phenylpyrrolidine-2,5-dione (PubChem CID 43410376) has the molecular formula C16H13FN2O2 and a molecular weight of 284.29 g/mol. Its IUPAC name is 3-(3-fluoroanilino)-1-phenylpyrrolidine-2,5-dione.
| Compound Name | 3-(3-fluoroanilino)-1-phenylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 43410376 |
| Molecular Formula | C16H13FN2O2 |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 3-(3-fluoroanilino)-1-phenylpyrrolidine-2,5-dione |
| SMILES | O=C1CC(Nc2cccc(F)c2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C16H13FN2O2/c17-11-5-4-6-12(9-11)18-14-10-15(20)19(16(14)21)13-7-2-1-3-8-13/h1-9,14,18H,10H2 |
| InChIKey | FZSHUOCAZJDLLY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|