C17H13FN2O5 — CID 43826788
4-[3-(3-fluoroanilino)-2,5-dioxopyrrolidin-1-yl]-2-hydroxybenzoic acid (PubChem CID 43826788) has the molecular formula C17H13FN2O5 and a molecular weight of 344.30 g/mol. Its IUPAC name is 4-[3-(3-fluoroanilino)-2,5-dioxopyrrolidin-1-yl]-2-hydroxybenzoic acid.
| Compound Name | 4-[3-(3-fluoroanilino)-2,5-dioxopyrrolidin-1-yl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 43826788 |
| Molecular Formula | C17H13FN2O5 |
| Molecular Weight | 344.30 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 4-[3-(3-fluoroanilino)-2,5-dioxopyrrolidin-1-yl]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1ccc(N2C(=O)CC(Nc3cccc(F)c3)C2=O)cc1O |
| InChI | InChI=1S/C17H13FN2O5/c18-9-2-1-3-10(6-9)19-13-8-15(22)20(16(13)23)11-4-5-12(17(24)25)14(21)7-11/h1-7,13,19,21H,8H2,(H,24,25) |
| InChIKey | CVHJEWFGFRHFCR-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.30 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|