C17H15FN2O3 — CID 93235253
(3S)-1-(4-fluorophenyl)-3-(2-methoxyanilino)pyrrolidine-2,5-dione (PubChem CID 93235253) has the molecular formula C17H15FN2O3 and a molecular weight of 314.32 g/mol. Its IUPAC name is (3S)-1-(4-fluorophenyl)-3-(2-methoxyanilino)pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-(4-fluorophenyl)-3-(2-methoxyanilino)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 93235253 |
| Molecular Formula | C17H15FN2O3 |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | (3S)-1-(4-fluorophenyl)-3-(2-methoxyanilino)pyrrolidine-2,5-dione |
| SMILES | COc1ccccc1N[C@H]1CC(=O)N(c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C17H15FN2O3/c1-23-15-5-3-2-4-13(15)19-14-10-16(21)20(17(14)22)12-8-6-11(18)7-9-12/h2-9,14,19H,10H2,1H3/t14-/m0/s1 |
| InChIKey | CTBZWMOZOSNRJL-AWEZNQCLSA-N |
| XLogP | 2.58 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|