C23H18N2O4 — CID 98554295
[2-[[(3R)-2,5-dioxo-1-phenylpyrrolidin-3-yl]amino]phenyl] benzoate (PubChem CID 98554295) has the molecular formula C23H18N2O4 and a molecular weight of 386.41 g/mol. Its IUPAC name is [2-[[(3R)-2,5-dioxo-1-phenylpyrrolidin-3-yl]amino]phenyl] benzoate.
| Compound Name | [2-[[(3R)-2,5-dioxo-1-phenylpyrrolidin-3-yl]amino]phenyl] benzoate |
|---|---|
| PubChem CID | 98554295 |
| Molecular Formula | C23H18N2O4 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | [2-[[(3R)-2,5-dioxo-1-phenylpyrrolidin-3-yl]amino]phenyl] benzoate |
| SMILES | O=C(Oc1ccccc1N[C@@H]1CC(=O)N(c2ccccc2)C1=O)c1ccccc1 |
| InChI | InChI=1S/C23H18N2O4/c26-21-15-19(22(27)25(21)17-11-5-2-6-12-17)24-18-13-7-8-14-20(18)29-23(28)16-9-3-1-4-10-16/h1-14,19,24H,15H2/t19-/m1/s1 |
| InChIKey | MSTZUYFPDXIAEF-LJQANCHMSA-N |
| XLogP | 3.65 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|