About (3S)-1-(2,6-dimethylphenyl)-3-(4-phenoxyanilino)pyrrolidine-2,5-dione
(3S)-1-(2,6-dimethylphenyl)-3-(4-phenoxyanilino)pyrrolidine-2,5-dione (PubChem CID 98368892) has the molecular formula C24H22N2O3
and a molecular weight of 386.45 g/mol. Its IUPAC name is (3S)-1-(2,6-dimethylphenyl)-3-(4-phenoxyanilino)pyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | (3S)-1-(2,6-dimethylphenyl)-3-(4-phenoxyanilino)pyrrolidine-2,5-dione |
| PubChem CID | 98368892 |
| Molecular Formula | C24H22N2O3 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | (3S)-1-(2,6-dimethylphenyl)-3-(4-phenoxyanilino)pyrrolidine-2,5-dione |
| SMILES | Cc1cccc(C)c1N1C(=O)C[C@H](Nc2ccc(Oc3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C24H22N2O3/c1-16-7-6-8-17(2)23(16)26-22(27)15-21(24(26)28)25-18-11-13-20(14-12-18)29-19-9-4-3-5-10-19/h3-14,21,25H,15H2,1-2H3/t21-/m0/s1 |
| InChIKey | JMWZWCDGYAYOFI-NRFANRHFSA-N |
| XLogP | 4.84 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (3S)-1-(2,6-dimethylphenyl)-3-(4-phenoxyanilino)pyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1-(2,6-dimethylphenyl)-3-(4-phenoxyanilino)pyrrolidine-2,5-dione?
The IUPAC name of (3S)-1-(2,6-dimethylphenyl)-3-(4-phenoxyanilino)pyrrolidine-2,5-dione (CID 98368892) is (3S)-1-(2,6-dimethylphenyl)-3-(4-phenoxyanilino)pyrrolidine-2,5-dione.
What is the SMILES notation for (3S)-1-(2,6-dimethylphenyl)-3-(4-phenoxyanilino)pyrrolidine-2,5-dione?
The canonical SMILES for (3S)-1-(2,6-dimethylphenyl)-3-(4-phenoxyanilino)pyrrolidine-2,5-dione is Cc1cccc(C)c1N1C(=O)C[C@H](Nc2ccc(Oc3ccccc3)cc2)C1=O.
What is the InChIKey of (3S)-1-(2,6-dimethylphenyl)-3-(4-phenoxyanilino)pyrrolidine-2,5-dione?
The InChIKey is JMWZWCDGYAYOFI-NRFANRHFSA-N. The full InChI is InChI=1S/C24H22N2O3/c1-16-7-6-8-17(2)23(16)26-22(27)15-21(24(26)28)25-18-11-13-20(14-12-18)29-19-9-4-3-5-10-19/h3-14,21,25H,15H2,1-2H3/t21-/m0/s1.
What are the key properties of (3S)-1-(2,6-dimethylphenyl)-3-(4-phenoxyanilino)pyrrolidine-2,5-dione?
(3S)-1-(2,6-dimethylphenyl)-3-(4-phenoxyanilino)pyrrolidine-2,5-dione has a molecular weight of 386.45 g/mol, XLogP of 4.84, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1-(2,6-dimethylphenyl)-3-(4-phenoxyanilino)pyrrolidine-2,5-dione is sourced from PubChem (CID 98368892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).