C18H24N4O6S — CID 2446641
N'-[(3S)-1-(2-methoxyethyl)-2,5-dioxopyrrolidin-3-yl]-4-pyrrolidin-1-ylsulfonylbenzohydrazide (PubChem CID 2446641) has the molecular formula C18H24N4O6S and a molecular weight of 424.48 g/mol. Its IUPAC name is N'-[(3S)-1-(2-methoxyethyl)-2,5-dioxopyrrolidin-3-yl]-4-pyrrolidin-1-ylsulfonylbenzohydrazide.
| Compound Name | N'-[(3S)-1-(2-methoxyethyl)-2,5-dioxopyrrolidin-3-yl]-4-pyrrolidin-1-ylsulfonylbenzohydrazide |
|---|---|
| PubChem CID | 2446641 |
| Molecular Formula | C18H24N4O6S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | N'-[(3S)-1-(2-methoxyethyl)-2,5-dioxopyrrolidin-3-yl]-4-pyrrolidin-1-ylsulfonylbenzohydrazide |
| SMILES | COCCN1C(=O)C[C@H](NNC(=O)c2ccc(S(=O)(=O)N3CCCC3)cc2)C1=O |
| InChI | InChI=1S/C18H24N4O6S/c1-28-11-10-22-16(23)12-15(18(22)25)19-20-17(24)13-4-6-14(7-5-13)29(26,27)21-8-2-3-9-21/h4-7,15,19H,2-3,8-12H2,1H3,(H,20,24)/t15-/m0/s1 |
| InChIKey | QTAZFVIRAPEOKE-HNNXBMFYSA-N |
| XLogP | -0.52 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|