C17H21Cl2N3O5S — CID 41059270
(3R)-3-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]-1-(2-methoxyethyl)pyrrolidine-2,5-dione (PubChem CID 41059270) has the molecular formula C17H21Cl2N3O5S and a molecular weight of 450.34 g/mol. Its IUPAC name is (3R)-3-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]-1-(2-methoxyethyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]-1-(2-methoxyethyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 41059270 |
| Molecular Formula | C17H21Cl2N3O5S |
| Molecular Weight | 450.34 g/mol |
| Exact Mass | 449.06 |
| IUPAC Name | (3R)-3-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]-1-(2-methoxyethyl)pyrrolidine-2,5-dione |
| SMILES | COCCN1C(=O)C[C@@H](N2CCN(S(=O)(=O)c3ccc(Cl)c(Cl)c3)CC2)C1=O |
| InChI | InChI=1S/C17H21Cl2N3O5S/c1-27-9-8-22-16(23)11-15(17(22)24)20-4-6-21(7-5-20)28(25,26)12-2-3-13(18)14(19)10-12/h2-3,10,15H,4-9,11H2,1H3/t15-/m1/s1 |
| InChIKey | IJOSYZRCFZEDTN-OAHLLOKOSA-N |
| XLogP | 1.07 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.34 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|