C24H27N3O6S — CID 41080963
(3R)-3-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazin-1-yl]-1-(2-phenylethyl)pyrrolidine-2,5-dione (PubChem CID 41080963) has the molecular formula C24H27N3O6S and a molecular weight of 485.56 g/mol. Its IUPAC name is (3R)-3-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazin-1-yl]-1-(2-phenylethyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazin-1-yl]-1-(2-phenylethyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 41080963 |
| Molecular Formula | C24H27N3O6S |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | (3R)-3-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazin-1-yl]-1-(2-phenylethyl)pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@@H](N2CCN(S(=O)(=O)c3ccc4c(c3)OCCO4)CC2)C(=O)N1CCc1ccccc1 |
| InChI | InChI=1S/C24H27N3O6S/c28-23-17-20(24(29)27(23)9-8-18-4-2-1-3-5-18)25-10-12-26(13-11-25)34(30,31)19-6-7-21-22(16-19)33-15-14-32-21/h1-7,16,20H,8-15,17H2/t20-/m1/s1 |
| InChIKey | YLAKFQLXEQRXLH-HXUWFJFHSA-N |
| XLogP | 1.13 |
| TPSA | 96.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|