C24H27N3O7S — CID 2093561
(3S)-3-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazin-1-yl]-1-(4-ethoxyphenyl)pyrrolidine-2,5-dione (PubChem CID 2093561) has the molecular formula C24H27N3O7S and a molecular weight of 501.56 g/mol. Its IUPAC name is (3S)-3-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazin-1-yl]-1-(4-ethoxyphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazin-1-yl]-1-(4-ethoxyphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 2093561 |
| Molecular Formula | C24H27N3O7S |
| Molecular Weight | 501.56 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | (3S)-3-[4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazin-1-yl]-1-(4-ethoxyphenyl)pyrrolidine-2,5-dione |
| SMILES | CCOc1ccc(N2C(=O)C[C@H](N3CCN(S(=O)(=O)c4ccc5c(c4)OCCO5)CC3)C2=O)cc1 |
| InChI | InChI=1S/C24H27N3O7S/c1-2-32-18-5-3-17(4-6-18)27-23(28)16-20(24(27)29)25-9-11-26(12-10-25)35(30,31)19-7-8-21-22(15-19)34-14-13-33-21/h3-8,15,20H,2,9-14,16H2,1H3/t20-/m0/s1 |
| InChIKey | BWTBLXGECPLKQN-FQEVSTJZSA-N |
| XLogP | 1.49 |
| TPSA | 105.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.56 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|