C16H23N3O5S — CID 70768216
N-(2-methoxyethyl)-4-[(4-methyl-5-oxo-1,4-diazepan-1-yl)sulfonyl]benzamide (PubChem CID 70768216) has the molecular formula C16H23N3O5S and a molecular weight of 369.44 g/mol. Its IUPAC name is N-(2-methoxyethyl)-4-[(4-methyl-5-oxo-1,4-diazepan-1-yl)sulfonyl]benzamide.
| Compound Name | N-(2-methoxyethyl)-4-[(4-methyl-5-oxo-1,4-diazepan-1-yl)sulfonyl]benzamide |
|---|---|
| PubChem CID | 70768216 |
| Molecular Formula | C16H23N3O5S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | N-(2-methoxyethyl)-4-[(4-methyl-5-oxo-1,4-diazepan-1-yl)sulfonyl]benzamide |
| SMILES | COCCNC(=O)c1ccc(S(=O)(=O)N2CCC(=O)N(C)CC2)cc1 |
| InChI | InChI=1S/C16H23N3O5S/c1-18-10-11-19(9-7-15(18)20)25(22,23)14-5-3-13(4-6-14)16(21)17-8-12-24-2/h3-6H,7-12H2,1-2H3,(H,17,21) |
| InChIKey | GISCXTRYTNLCSP-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|