C20H28N4O5S — CID 2492854
N'-[(3R)-1-(3-methylbutyl)-2,5-dioxopyrrolidin-3-yl]-4-pyrrolidin-1-ylsulfonylbenzohydrazide (PubChem CID 2492854) has the molecular formula C20H28N4O5S and a molecular weight of 436.53 g/mol. Its IUPAC name is N'-[(3R)-1-(3-methylbutyl)-2,5-dioxopyrrolidin-3-yl]-4-pyrrolidin-1-ylsulfonylbenzohydrazide.
| Compound Name | N'-[(3R)-1-(3-methylbutyl)-2,5-dioxopyrrolidin-3-yl]-4-pyrrolidin-1-ylsulfonylbenzohydrazide |
|---|---|
| PubChem CID | 2492854 |
| Molecular Formula | C20H28N4O5S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | N'-[(3R)-1-(3-methylbutyl)-2,5-dioxopyrrolidin-3-yl]-4-pyrrolidin-1-ylsulfonylbenzohydrazide |
| SMILES | CC(C)CCN1C(=O)C[C@@H](NNC(=O)c2ccc(S(=O)(=O)N3CCCC3)cc2)C1=O |
| InChI | InChI=1S/C20H28N4O5S/c1-14(2)9-12-24-18(25)13-17(20(24)27)21-22-19(26)15-5-7-16(8-6-15)30(28,29)23-10-3-4-11-23/h5-8,14,17,21H,3-4,9-13H2,1-2H3,(H,22,26)/t17-/m1/s1 |
| InChIKey | GHXANEXBEOADEE-QGZVFWFLSA-N |
| XLogP | 0.88 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|