C24H28N4O5S — CID 121048631
N-[[3-(2-methoxyethyl)-4-oxophthalazin-1-yl]methyl]-4-piperidin-1-ylsulfonylbenzamide (PubChem CID 121048631) has the molecular formula C24H28N4O5S and a molecular weight of 484.58 g/mol. Its IUPAC name is N-[[3-(2-methoxyethyl)-4-oxophthalazin-1-yl]methyl]-4-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-[[3-(2-methoxyethyl)-4-oxophthalazin-1-yl]methyl]-4-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 121048631 |
| Molecular Formula | C24H28N4O5S |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | N-[[3-(2-methoxyethyl)-4-oxophthalazin-1-yl]methyl]-4-piperidin-1-ylsulfonylbenzamide |
| SMILES | COCCn1nc(CNC(=O)c2ccc(S(=O)(=O)N3CCCCC3)cc2)c2ccccc2c1=O |
| InChI | InChI=1S/C24H28N4O5S/c1-33-16-15-28-24(30)21-8-4-3-7-20(21)22(26-28)17-25-23(29)18-9-11-19(12-10-18)34(31,32)27-13-5-2-6-14-27/h3-4,7-12H,2,5-6,13-17H2,1H3,(H,25,29) |
| InChIKey | WADXGKKSBPIOQR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |