C16H21N3O4 — CID 2492862
4-ethyl-N'-[(3R)-1-(2-methoxyethyl)-2,5-dioxopyrrolidin-3-yl]benzohydrazide (PubChem CID 2492862) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is 4-ethyl-N'-[(3R)-1-(2-methoxyethyl)-2,5-dioxopyrrolidin-3-yl]benzohydrazide.
| Compound Name | 4-ethyl-N'-[(3R)-1-(2-methoxyethyl)-2,5-dioxopyrrolidin-3-yl]benzohydrazide |
|---|---|
| PubChem CID | 2492862 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 4-ethyl-N'-[(3R)-1-(2-methoxyethyl)-2,5-dioxopyrrolidin-3-yl]benzohydrazide |
| SMILES | CCc1ccc(C(=O)NN[C@@H]2CC(=O)N(CCOC)C2=O)cc1 |
| InChI | InChI=1S/C16H21N3O4/c1-3-11-4-6-12(7-5-11)15(21)18-17-13-10-14(20)19(16(13)22)8-9-23-2/h4-7,13,17H,3,8-10H2,1-2H3,(H,18,21)/t13-/m1/s1 |
| InChIKey | ZHVJLBPSJLJQBW-CYBMUJFWSA-N |
| XLogP | 0.26 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|