C17H22N2O3 — CID 71181447
4-ethyl-N-[2-(3-ethyl-2,5-dioxopyrrolidin-1-yl)ethyl]benzamide (PubChem CID 71181447) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is 4-ethyl-N-[2-(3-ethyl-2,5-dioxopyrrolidin-1-yl)ethyl]benzamide.
| Compound Name | 4-ethyl-N-[2-(3-ethyl-2,5-dioxopyrrolidin-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 71181447 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 4-ethyl-N-[2-(3-ethyl-2,5-dioxopyrrolidin-1-yl)ethyl]benzamide |
| SMILES | CCc1ccc(C(=O)NCCN2C(=O)CC(CC)C2=O)cc1 |
| InChI | InChI=1S/C17H22N2O3/c1-3-12-5-7-14(8-6-12)16(21)18-9-10-19-15(20)11-13(4-2)17(19)22/h5-8,13H,3-4,9-11H2,1-2H3,(H,18,21) |
| InChIKey | WIVMPXGLBHOIQL-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|