C14H16N2O5 — CID 98289728
(3R)-3-(1,3-benzodioxol-5-ylamino)-1-(2-methoxyethyl)pyrrolidine-2,5-dione (PubChem CID 98289728) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is (3R)-3-(1,3-benzodioxol-5-ylamino)-1-(2-methoxyethyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-(1,3-benzodioxol-5-ylamino)-1-(2-methoxyethyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 98289728 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | (3R)-3-(1,3-benzodioxol-5-ylamino)-1-(2-methoxyethyl)pyrrolidine-2,5-dione |
| SMILES | COCCN1C(=O)C[C@@H](Nc2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C14H16N2O5/c1-19-5-4-16-13(17)7-10(14(16)18)15-9-2-3-11-12(6-9)21-8-20-11/h2-3,6,10,15H,4-5,7-8H2,1H3/t10-/m1/s1 |
| InChIKey | AKWSHIXPTNMXQY-SNVBAGLBSA-N |
| XLogP | 0.60 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|