C19H18N4O5 — CID 52971593
(3E)-1-(1,3-benzodioxol-5-yl)-3-[3-(2-methoxyethyl)-2-oxo-4aH-quinazolin-4-ylidene]urea (PubChem CID 52971593) has the molecular formula C19H18N4O5 and a molecular weight of 382.38 g/mol. Its IUPAC name is (3E)-1-(1,3-benzodioxol-5-yl)-3-[3-(2-methoxyethyl)-2-oxo-4aH-quinazolin-4-ylidene]urea.
| Compound Name | (3E)-1-(1,3-benzodioxol-5-yl)-3-[3-(2-methoxyethyl)-2-oxo-4aH-quinazolin-4-ylidene]urea |
|---|---|
| PubChem CID | 52971593 |
| Molecular Formula | C19H18N4O5 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | (3E)-1-(1,3-benzodioxol-5-yl)-3-[3-(2-methoxyethyl)-2-oxo-4aH-quinazolin-4-ylidene]urea |
| SMILES | COCCN1C(=O)N=C2C=CC=CC2/C1=N\C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H18N4O5/c1-26-9-8-23-17(13-4-2-3-5-14(13)21-19(23)25)22-18(24)20-12-6-7-15-16(10-12)28-11-27-15/h2-7,10,13H,8-9,11H2,1H3,(H,20,24)/b22-17+ |
| InChIKey | QTTRWFHOCVMLQT-OQKWZONESA-N |
| XLogP | 2.61 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|