C15H17N3O5 — CID 108508457
2-(4-acetylpiperazin-1-yl)-N-(1,3-benzodioxol-5-yl)-2-oxoacetamide (PubChem CID 108508457) has the molecular formula C15H17N3O5 and a molecular weight of 319.32 g/mol. Its IUPAC name is 2-(4-acetylpiperazin-1-yl)-N-(1,3-benzodioxol-5-yl)-2-oxoacetamide.
| Compound Name | 2-(4-acetylpiperazin-1-yl)-N-(1,3-benzodioxol-5-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 108508457 |
| Molecular Formula | C15H17N3O5 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 2-(4-acetylpiperazin-1-yl)-N-(1,3-benzodioxol-5-yl)-2-oxoacetamide |
| SMILES | CC(=O)N1CCN(C(=O)C(=O)Nc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C15H17N3O5/c1-10(19)17-4-6-18(7-5-17)15(21)14(20)16-11-2-3-12-13(8-11)23-9-22-12/h2-3,8H,4-7,9H2,1H3,(H,16,20) |
| InChIKey | ZEQCCSZPKICNMF-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|