C15H17N3O5 — CID 44996912
1-[2-(1,3-benzodioxol-5-ylamino)-2-oxoacetyl]piperidine-4-carboxamide (PubChem CID 44996912) has the molecular formula C15H17N3O5 and a molecular weight of 319.32 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-ylamino)-2-oxoacetyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-(1,3-benzodioxol-5-ylamino)-2-oxoacetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 44996912 |
| Molecular Formula | C15H17N3O5 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-ylamino)-2-oxoacetyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C(=O)C(=O)Nc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C15H17N3O5/c16-13(19)9-3-5-18(6-4-9)15(21)14(20)17-10-1-2-11-12(7-10)23-8-22-11/h1-2,7,9H,3-6,8H2,(H2,16,19)(H,17,20) |
| InChIKey | SBCYQBPRBHKKJA-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|