C12H15N3O4S — CID 742569
4-[[[(3R)-1-methyl-2,5-dioxopyrrolidin-3-yl]amino]methyl]benzenesulfonamide (PubChem CID 742569) has the molecular formula C12H15N3O4S and a molecular weight of 297.34 g/mol. Its IUPAC name is 4-[[[(3R)-1-methyl-2,5-dioxopyrrolidin-3-yl]amino]methyl]benzenesulfonamide.
| Compound Name | 4-[[[(3R)-1-methyl-2,5-dioxopyrrolidin-3-yl]amino]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 742569 |
| Molecular Formula | C12H15N3O4S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 4-[[[(3R)-1-methyl-2,5-dioxopyrrolidin-3-yl]amino]methyl]benzenesulfonamide |
| SMILES | CN1C(=O)C[C@@H](NCc2ccc(S(N)(=O)=O)cc2)C1=O |
| InChI | InChI=1S/C12H15N3O4S/c1-15-11(16)6-10(12(15)17)14-7-8-2-4-9(5-3-8)20(13,18)19/h2-5,10,14H,6-7H2,1H3,(H2,13,18,19)/t10-/m1/s1 |
| InChIKey | NHCRIZAUQBOVQE-SNVBAGLBSA-N |
| XLogP | -0.82 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|