C17H16IN3O4S — CID 1418366
4-[[[(3R)-1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]amino]methyl]benzenesulfonamide (PubChem CID 1418366) has the molecular formula C17H16IN3O4S and a molecular weight of 485.30 g/mol. Its IUPAC name is 4-[[[(3R)-1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]amino]methyl]benzenesulfonamide.
| Compound Name | 4-[[[(3R)-1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]amino]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 1418366 |
| Molecular Formula | C17H16IN3O4S |
| Molecular Weight | 485.30 g/mol |
| Exact Mass | 484.99 |
| IUPAC Name | 4-[[[(3R)-1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]amino]methyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CN[C@@H]2CC(=O)N(c3ccc(I)cc3)C2=O)cc1 |
| InChI | InChI=1S/C17H16IN3O4S/c18-12-3-5-13(6-4-12)21-16(22)9-15(17(21)23)20-10-11-1-7-14(8-2-11)26(19,24)25/h1-8,15,20H,9-10H2,(H2,19,24,25)/t15-/m1/s1 |
| InChIKey | SUXBCJKUIIPOLI-OAHLLOKOSA-N |
| XLogP | 1.36 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.30 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|