C19H29N3O2+2 — CID 7392954
(3R)-3-(4-benzylpiperazine-1,4-diium-1-yl)-1-(2-methylpropyl)pyrrolidine-2,5-dione (PubChem CID 7392954) has the molecular formula C19H29N3O2+2 and a molecular weight of 331.46 g/mol. Its IUPAC name is (3R)-3-(4-benzylpiperazine-1,4-diium-1-yl)-1-(2-methylpropyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-(4-benzylpiperazine-1,4-diium-1-yl)-1-(2-methylpropyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7392954 |
| Molecular Formula | C19H29N3O2+2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.22 |
| IUPAC Name | (3R)-3-(4-benzylpiperazine-1,4-diium-1-yl)-1-(2-methylpropyl)pyrrolidine-2,5-dione |
| SMILES | CC(C)CN1C(=O)C[C@@H]([NH+]2CC[NH+](Cc3ccccc3)CC2)C1=O |
| InChI | InChI=1S/C19H27N3O2/c1-15(2)13-22-18(23)12-17(19(22)24)21-10-8-20(9-11-21)14-16-6-4-3-5-7-16/h3-7,15,17H,8-14H2,1-2H3/p+2/t17-/m1/s1 |
| InChIKey | CMEHVYXSQKLRCN-QGZVFWFLSA-P |
| XLogP | -1.25 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|