C22H27N3O3+2 — CID 4753159
3-(4-benzylpiperazine-1,4-diium-1-yl)-1-(2-methoxyphenyl)pyrrolidine-2,5-dione (PubChem CID 4753159) has the molecular formula C22H27N3O3+2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 3-(4-benzylpiperazine-1,4-diium-1-yl)-1-(2-methoxyphenyl)pyrrolidine-2,5-dione.
| Compound Name | 3-(4-benzylpiperazine-1,4-diium-1-yl)-1-(2-methoxyphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 4753159 |
| Molecular Formula | C22H27N3O3+2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | 3-(4-benzylpiperazine-1,4-diium-1-yl)-1-(2-methoxyphenyl)pyrrolidine-2,5-dione |
| SMILES | COc1ccccc1N1C(=O)CC([NH+]2CC[NH+](Cc3ccccc3)CC2)C1=O |
| InChI | InChI=1S/C22H25N3O3/c1-28-20-10-6-5-9-18(20)25-21(26)15-19(22(25)27)24-13-11-23(12-14-24)16-17-7-3-2-4-8-17/h2-10,19H,11-16H2,1H3/p+2 |
| InChIKey | VSQUMUPYVXETIG-UHFFFAOYSA-P |
| XLogP | -0.69 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|