C21H23N4O5+ — CID 7317290
(3R)-3-[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]-1-(4-nitrophenyl)pyrrolidine-2,5-dione (PubChem CID 7317290) has the molecular formula C21H23N4O5+ and a molecular weight of 411.44 g/mol. Its IUPAC name is (3R)-3-[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]-1-(4-nitrophenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]-1-(4-nitrophenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7317290 |
| Molecular Formula | C21H23N4O5+ |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | (3R)-3-[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]-1-(4-nitrophenyl)pyrrolidine-2,5-dione |
| SMILES | COc1ccccc1N1CC[NH+]([C@@H]2CC(=O)N(c3ccc([N+](=O)[O-])cc3)C2=O)CC1 |
| InChI | InChI=1S/C21H22N4O5/c1-30-19-5-3-2-4-17(19)22-10-12-23(13-11-22)18-14-20(26)24(21(18)27)15-6-8-16(9-7-15)25(28)29/h2-9,18H,10-14H2,1H3/p+1/t18-/m1/s1 |
| InChIKey | JBVVRBGZTCQRGM-GOSISDBHSA-O |
| XLogP | 0.64 |
| TPSA | 97.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|