C25H33N3O2+2 — CID 9279605
(3S)-3-phenyl-1-[[4-[(4-propan-2-ylphenyl)methyl]piperazine-1,4-diium-1-yl]methyl]pyrrolidine-2,5-dione (PubChem CID 9279605) has the molecular formula C25H33N3O2+2 and a molecular weight of 407.56 g/mol. Its IUPAC name is (3S)-3-phenyl-1-[[4-[(4-propan-2-ylphenyl)methyl]piperazine-1,4-diium-1-yl]methyl]pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-phenyl-1-[[4-[(4-propan-2-ylphenyl)methyl]piperazine-1,4-diium-1-yl]methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 9279605 |
| Molecular Formula | C25H33N3O2+2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | (3S)-3-phenyl-1-[[4-[(4-propan-2-ylphenyl)methyl]piperazine-1,4-diium-1-yl]methyl]pyrrolidine-2,5-dione |
| SMILES | CC(C)c1ccc(C[NH+]2CC[NH+](CN3C(=O)C[C@@H](c4ccccc4)C3=O)CC2)cc1 |
| InChI | InChI=1S/C25H31N3O2/c1-19(2)21-10-8-20(9-11-21)17-26-12-14-27(15-13-26)18-28-24(29)16-23(25(28)30)22-6-4-3-5-7-22/h3-11,19,23H,12-18H2,1-2H3/p+2/t23-/m0/s1 |
| InChIKey | CNNPAJPHBXLLMO-QHCPKHFHSA-P |
| XLogP | 0.59 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|