C24H29N3O4+2 — CID 6971882
(3R)-3-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1,4-diium-1-yl]-1-(2,5-dimethylphenyl)pyrrolidine-2,5-dione (PubChem CID 6971882) has the molecular formula C24H29N3O4+2 and a molecular weight of 423.51 g/mol. Its IUPAC name is (3R)-3-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1,4-diium-1-yl]-1-(2,5-dimethylphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1,4-diium-1-yl]-1-(2,5-dimethylphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 6971882 |
| Molecular Formula | C24H29N3O4+2 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | (3R)-3-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1,4-diium-1-yl]-1-(2,5-dimethylphenyl)pyrrolidine-2,5-dione |
| SMILES | Cc1ccc(C)c(N2C(=O)C[C@@H]([NH+]3CC[NH+](Cc4ccc5c(c4)OCO5)CC3)C2=O)c1 |
| InChI | InChI=1S/C24H27N3O4/c1-16-3-4-17(2)19(11-16)27-23(28)13-20(24(27)29)26-9-7-25(8-10-26)14-18-5-6-21-22(12-18)31-15-30-21/h3-6,11-12,20H,7-10,13-15H2,1-2H3/p+2/t20-/m1/s1 |
| InChIKey | LXAFBBKHOSZCSH-HXUWFJFHSA-P |
| XLogP | -0.35 |
| TPSA | 64.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|