C18H24N3O3+ — CID 6953255
1-[(3S)-1-(2,5-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]piperidin-1-ium-4-carboxamide (PubChem CID 6953255) has the molecular formula C18H24N3O3+ and a molecular weight of 330.41 g/mol. Its IUPAC name is 1-[(3S)-1-(2,5-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]piperidin-1-ium-4-carboxamide.
| Compound Name | 1-[(3S)-1-(2,5-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 6953255 |
| Molecular Formula | C18H24N3O3+ |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 1-[(3S)-1-(2,5-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]piperidin-1-ium-4-carboxamide |
| SMILES | Cc1ccc(C)c(N2C(=O)C[C@H]([NH+]3CCC(C(N)=O)CC3)C2=O)c1 |
| InChI | InChI=1S/C18H23N3O3/c1-11-3-4-12(2)14(9-11)21-16(22)10-15(18(21)24)20-7-5-13(6-8-20)17(19)23/h3-4,9,13,15H,5-8,10H2,1-2H3,(H2,19,23)/p+1/t15-/m0/s1 |
| InChIKey | SHHZFASOQAOIGM-HNNXBMFYSA-O |
| XLogP | -0.28 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|