C17H20N3O5+ — CID 7333031
1-[(3R)-1-(1,3-benzodioxol-5-yl)-2,5-dioxopyrrolidin-3-yl]piperidin-1-ium-4-carboxamide (PubChem CID 7333031) has the molecular formula C17H20N3O5+ and a molecular weight of 346.36 g/mol. Its IUPAC name is 1-[(3R)-1-(1,3-benzodioxol-5-yl)-2,5-dioxopyrrolidin-3-yl]piperidin-1-ium-4-carboxamide.
| Compound Name | 1-[(3R)-1-(1,3-benzodioxol-5-yl)-2,5-dioxopyrrolidin-3-yl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 7333031 |
| Molecular Formula | C17H20N3O5+ |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 1-[(3R)-1-(1,3-benzodioxol-5-yl)-2,5-dioxopyrrolidin-3-yl]piperidin-1-ium-4-carboxamide |
| SMILES | NC(=O)C1CC[NH+]([C@@H]2CC(=O)N(c3ccc4c(c3)OCO4)C2=O)CC1 |
| InChI | InChI=1S/C17H19N3O5/c18-16(22)10-3-5-19(6-4-10)12-8-15(21)20(17(12)23)11-1-2-13-14(7-11)25-9-24-13/h1-2,7,10,12H,3-6,8-9H2,(H2,18,22)/p+1/t12-/m1/s1 |
| InChIKey | BDVQJBIZTIQYRP-GFCCVEGCSA-O |
| XLogP | -1.17 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|