C17H20N2O4 — CID 4068506
1-[1-(3-methylphenyl)-2,5-dioxopyrrolidin-3-yl]piperidin-1-ium-4-carboxylate (PubChem CID 4068506) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is 1-[1-(3-methylphenyl)-2,5-dioxopyrrolidin-3-yl]piperidin-1-ium-4-carboxylate.
| Compound Name | 1-[1-(3-methylphenyl)-2,5-dioxopyrrolidin-3-yl]piperidin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 4068506 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 1-[1-(3-methylphenyl)-2,5-dioxopyrrolidin-3-yl]piperidin-1-ium-4-carboxylate |
| SMILES | Cc1cccc(N2C(=O)CC([NH+]3CCC(C(=O)[O-])CC3)C2=O)c1 |
| InChI | InChI=1S/C17H20N2O4/c1-11-3-2-4-13(9-11)19-15(20)10-14(16(19)21)18-7-5-12(6-8-18)17(22)23/h2-4,9,12,14H,5-8,10H2,1H3,(H,22,23) |
| InChIKey | NBSFPYHMEXCTTR-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|