C21H22Cl2N3O2+ — CID 7376192
(3R)-3-[4-(3,4-dichlorophenyl)piperazin-1-ium-1-yl]-1-(3-methylphenyl)pyrrolidine-2,5-dione (PubChem CID 7376192) has the molecular formula C21H22Cl2N3O2+ and a molecular weight of 419.33 g/mol. Its IUPAC name is (3R)-3-[4-(3,4-dichlorophenyl)piperazin-1-ium-1-yl]-1-(3-methylphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[4-(3,4-dichlorophenyl)piperazin-1-ium-1-yl]-1-(3-methylphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7376192 |
| Molecular Formula | C21H22Cl2N3O2+ |
| Molecular Weight | 419.33 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | (3R)-3-[4-(3,4-dichlorophenyl)piperazin-1-ium-1-yl]-1-(3-methylphenyl)pyrrolidine-2,5-dione |
| SMILES | Cc1cccc(N2C(=O)C[C@@H]([NH+]3CCN(c4ccc(Cl)c(Cl)c4)CC3)C2=O)c1 |
| InChI | InChI=1S/C21H21Cl2N3O2/c1-14-3-2-4-16(11-14)26-20(27)13-19(21(26)28)25-9-7-24(8-10-25)15-5-6-17(22)18(23)12-15/h2-6,11-12,19H,7-10,13H2,1H3/p+1/t19-/m1/s1 |
| InChIKey | JGFNPVCPFIFKBP-LJQANCHMSA-O |
| XLogP | 2.34 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.33 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|