C15H15ClFN2O3+ — CID 7331357
(3S)-1-(3-chloro-4-fluorophenyl)-3-(4-oxopiperidin-1-ium-1-yl)pyrrolidine-2,5-dione (PubChem CID 7331357) has the molecular formula C15H15ClFN2O3+ and a molecular weight of 325.75 g/mol. Its IUPAC name is (3S)-1-(3-chloro-4-fluorophenyl)-3-(4-oxopiperidin-1-ium-1-yl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-(3-chloro-4-fluorophenyl)-3-(4-oxopiperidin-1-ium-1-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7331357 |
| Molecular Formula | C15H15ClFN2O3+ |
| Molecular Weight | 325.75 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | (3S)-1-(3-chloro-4-fluorophenyl)-3-(4-oxopiperidin-1-ium-1-yl)pyrrolidine-2,5-dione |
| SMILES | O=C1CC[NH+]([C@H]2CC(=O)N(c3ccc(F)c(Cl)c3)C2=O)CC1 |
| InChI | InChI=1S/C15H14ClFN2O3/c16-11-7-9(1-2-12(11)17)19-14(21)8-13(15(19)22)18-5-3-10(20)4-6-18/h1-2,7,13H,3-6,8H2/p+1/t13-/m0/s1 |
| InChIKey | MVIZUGAGRURBEV-ZDUSSCGKSA-O |
| XLogP | 0.36 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.75 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|