C19H22N3O3S+ — CID 7304781
(3R)-3-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]-1-(thiophen-2-ylmethyl)pyrrolidine-2,5-dione (PubChem CID 7304781) has the molecular formula C19H22N3O3S+ and a molecular weight of 372.47 g/mol. Its IUPAC name is (3R)-3-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]-1-(thiophen-2-ylmethyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]-1-(thiophen-2-ylmethyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7304781 |
| Molecular Formula | C19H22N3O3S+ |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | (3R)-3-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]-1-(thiophen-2-ylmethyl)pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@@H]([NH+]2CCN(c3ccccc3O)CC2)C(=O)N1Cc1cccs1 |
| InChI | InChI=1S/C19H21N3O3S/c23-17-6-2-1-5-15(17)20-7-9-21(10-8-20)16-12-18(24)22(19(16)25)13-14-4-3-11-26-14/h1-6,11,16,23H,7-10,12-13H2/p+1/t16-/m1/s1 |
| InChIKey | NLZPLIKUUUNOAA-MRXNPFEDSA-O |
| XLogP | 0.49 |
| TPSA | 65.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|