C26H28N4O3S3 — CID 57014999
4-[[4-(2-hydroxyphenyl)piperazin-1-yl]methylidene]-2,6-bis(2-thiophen-2-ylethyl)-1,2,6-thiadiazinane-3,5-dione (PubChem CID 57014999) has the molecular formula C26H28N4O3S3 and a molecular weight of 540.74 g/mol. Its IUPAC name is 4-[[4-(2-hydroxyphenyl)piperazin-1-yl]methylidene]-2,6-bis(2-thiophen-2-ylethyl)-1,2,6-thiadiazinane-3,5-dione.
| Compound Name | 4-[[4-(2-hydroxyphenyl)piperazin-1-yl]methylidene]-2,6-bis(2-thiophen-2-ylethyl)-1,2,6-thiadiazinane-3,5-dione |
|---|---|
| PubChem CID | 57014999 |
| Molecular Formula | C26H28N4O3S3 |
| Molecular Weight | 540.74 g/mol |
| Exact Mass | 540.13 |
| IUPAC Name | 4-[[4-(2-hydroxyphenyl)piperazin-1-yl]methylidene]-2,6-bis(2-thiophen-2-ylethyl)-1,2,6-thiadiazinane-3,5-dione |
| SMILES | O=C1C(=CN2CCN(c3ccccc3O)CC2)C(=O)N(CCc2cccs2)SN1CCc1cccs1 |
| InChI | InChI=1S/C26H28N4O3S3/c31-24-8-2-1-7-23(24)28-15-13-27(14-16-28)19-22-25(32)29(11-9-20-5-3-17-34-20)36-30(26(22)33)12-10-21-6-4-18-35-21/h1-8,17-19,31H,9-16H2 |
| InChIKey | MREOYVUIRAHILV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 67.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.74 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|