C12H15NO2S — CID 13455297
4-methyl-1-(2-thiophen-2-ylethyl)piperidine-2,6-dione (PubChem CID 13455297) has the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. Its IUPAC name is 4-methyl-1-(2-thiophen-2-ylethyl)piperidine-2,6-dione.
| Compound Name | 4-methyl-1-(2-thiophen-2-ylethyl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 13455297 |
| Molecular Formula | C12H15NO2S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 4-methyl-1-(2-thiophen-2-ylethyl)piperidine-2,6-dione |
| SMILES | CC1CC(=O)N(CCc2cccs2)C(=O)C1 |
| InChI | InChI=1S/C12H15NO2S/c1-9-7-11(14)13(12(15)8-9)5-4-10-3-2-6-16-10/h2-3,6,9H,4-5,7-8H2,1H3 |
| InChIKey | ICRSGLKYUNAQTG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|