C11H16BrNS — CID 130948914
4-bromo-2-methyl-1-(2-thiophen-2-ylethyl)pyrrolidine (PubChem CID 130948914) has the molecular formula C11H16BrNS and a molecular weight of 274.23 g/mol. Its IUPAC name is 4-bromo-2-methyl-1-(2-thiophen-2-ylethyl)pyrrolidine.
| Compound Name | 4-bromo-2-methyl-1-(2-thiophen-2-ylethyl)pyrrolidine |
|---|---|
| PubChem CID | 130948914 |
| Molecular Formula | C11H16BrNS |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 4-bromo-2-methyl-1-(2-thiophen-2-ylethyl)pyrrolidine |
| SMILES | CC1CC(Br)CN1CCc1cccs1 |
| InChI | InChI=1S/C11H16BrNS/c1-9-7-10(12)8-13(9)5-4-11-3-2-6-14-11/h2-3,6,9-10H,4-5,7-8H2,1H3 |
| InChIKey | JHCOMGOTEAYPPM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|