C13H22N2S — CID 64845507
2,2,5-trimethyl-1-(2-thiophen-2-ylethyl)piperazine (PubChem CID 64845507) has the molecular formula C13H22N2S and a molecular weight of 238.40 g/mol. Its IUPAC name is 2,2,5-trimethyl-1-(2-thiophen-2-ylethyl)piperazine.
| Compound Name | 2,2,5-trimethyl-1-(2-thiophen-2-ylethyl)piperazine |
|---|---|
| PubChem CID | 64845507 |
| Molecular Formula | C13H22N2S |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 2,2,5-trimethyl-1-(2-thiophen-2-ylethyl)piperazine |
| SMILES | CC1CN(CCc2cccs2)C(C)(C)CN1 |
| InChI | InChI=1S/C13H22N2S/c1-11-9-15(13(2,3)10-14-11)7-6-12-5-4-8-16-12/h4-5,8,11,14H,6-7,9-10H2,1-3H3 |
| InChIKey | ROOOSEJZGXXEEW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |