C22H28N4O3S3 — CID 57124637
4-(2-morpholin-4-ylethyliminomethyl)-2,6-bis(2-thiophen-2-ylethyl)-1,2,6-thiadiazinane-3,5-dione (PubChem CID 57124637) has the molecular formula C22H28N4O3S3 and a molecular weight of 492.69 g/mol. Its IUPAC name is 4-(2-morpholin-4-ylethyliminomethyl)-2,6-bis(2-thiophen-2-ylethyl)-1,2,6-thiadiazinane-3,5-dione.
| Compound Name | 4-(2-morpholin-4-ylethyliminomethyl)-2,6-bis(2-thiophen-2-ylethyl)-1,2,6-thiadiazinane-3,5-dione |
|---|---|
| PubChem CID | 57124637 |
| Molecular Formula | C22H28N4O3S3 |
| Molecular Weight | 492.69 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | 4-(2-morpholin-4-ylethyliminomethyl)-2,6-bis(2-thiophen-2-ylethyl)-1,2,6-thiadiazinane-3,5-dione |
| SMILES | O=C1C(/C=N/CCN2CCOCC2)C(=O)N(CCc2cccs2)SN1CCc1cccs1 |
| InChI | InChI=1S/C22H28N4O3S3/c27-21-20(17-23-7-10-24-11-13-29-14-12-24)22(28)26(9-6-19-4-2-16-31-19)32-25(21)8-5-18-3-1-15-30-18/h1-4,15-17,20H,5-14H2/b23-17+ |
| InChIKey | SAKGLEUFPOECLA-HAVVHWLPSA-N |
| XLogP | 2.85 |
| TPSA | 65.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.69 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|