C18H19F3N4O4 — CID 7367379
(5S)-5-(2-morpholin-4-ylethyliminomethyl)-1-[3-(trifluoromethyl)phenyl]-1,3-diazinane-2,4,6-trione (PubChem CID 7367379) has the molecular formula C18H19F3N4O4 and a molecular weight of 412.37 g/mol. Its IUPAC name is (5S)-5-(2-morpholin-4-ylethyliminomethyl)-1-[3-(trifluoromethyl)phenyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5S)-5-(2-morpholin-4-ylethyliminomethyl)-1-[3-(trifluoromethyl)phenyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7367379 |
| Molecular Formula | C18H19F3N4O4 |
| Molecular Weight | 412.37 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | (5S)-5-(2-morpholin-4-ylethyliminomethyl)-1-[3-(trifluoromethyl)phenyl]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)N(c2cccc(C(F)(F)F)c2)C(=O)[C@H]1/C=N/CCN1CCOCC1 |
| InChI | InChI=1S/C18H19F3N4O4/c19-18(20,21)12-2-1-3-13(10-12)25-16(27)14(15(26)23-17(25)28)11-22-4-5-24-6-8-29-9-7-24/h1-3,10-11,14H,4-9H2,(H,23,26,28)/b22-11+/t14-/m0/s1 |
| InChIKey | IUNSKFSEWREJNH-HYLGSWLWSA-N |
| XLogP | 1.31 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.37 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|