C18H22FN4O4+ — CID 7461223
(5S)-1-(2-fluorophenyl)-5-(3-morpholin-4-ium-4-ylpropyliminomethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 7461223) has the molecular formula C18H22FN4O4+ and a molecular weight of 377.40 g/mol. Its IUPAC name is (5S)-1-(2-fluorophenyl)-5-(3-morpholin-4-ium-4-ylpropyliminomethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5S)-1-(2-fluorophenyl)-5-(3-morpholin-4-ium-4-ylpropyliminomethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7461223 |
| Molecular Formula | C18H22FN4O4+ |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | (5S)-1-(2-fluorophenyl)-5-(3-morpholin-4-ium-4-ylpropyliminomethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)N(c2ccccc2F)C(=O)[C@H]1/C=N/CCC[NH+]1CCOCC1 |
| InChI | InChI=1S/C18H21FN4O4/c19-14-4-1-2-5-15(14)23-17(25)13(16(24)21-18(23)26)12-20-6-3-7-22-8-10-27-11-9-22/h1-2,4-5,12-13H,3,6-11H2,(H,21,24,26)/p+1/b20-12+/t13-/m0/s1 |
| InChIKey | DUXQXEUVOQBVRB-DZUMZMOTSA-O |
| XLogP | -0.60 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|