C19H27N5O3+2 — CID 6997926
(5R)-1-(4-ethylphenyl)-5-(2-piperazine-1,4-diium-1-ylethyliminomethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 6997926) has the molecular formula C19H27N5O3+2 and a molecular weight of 373.46 g/mol. Its IUPAC name is (5R)-1-(4-ethylphenyl)-5-(2-piperazine-1,4-diium-1-ylethyliminomethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5R)-1-(4-ethylphenyl)-5-(2-piperazine-1,4-diium-1-ylethyliminomethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 6997926 |
| Molecular Formula | C19H27N5O3+2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | (5R)-1-(4-ethylphenyl)-5-(2-piperazine-1,4-diium-1-ylethyliminomethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CCc1ccc(N2C(=O)NC(=O)[C@@H](/C=N/CC[NH+]3CC[NH2+]CC3)C2=O)cc1 |
| InChI | InChI=1S/C19H25N5O3/c1-2-14-3-5-15(6-4-14)24-18(26)16(17(25)22-19(24)27)13-21-9-12-23-10-7-20-8-11-23/h3-6,13,16,20H,2,7-12H2,1H3,(H,22,25,27)/p+2/b21-13+/t16-/m1/s1 |
| InChIKey | ULLTWOKMYCYIIM-WMRWHDLOSA-P |
| XLogP | -2.02 |
| TPSA | 99.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|