C18H25N4O4+ — CID 7367137
3-[[(5R)-1-(4-ethoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]propyl-dimethylazanium (PubChem CID 7367137) has the molecular formula C18H25N4O4+ and a molecular weight of 361.42 g/mol. Its IUPAC name is 3-[[(5R)-1-(4-ethoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]propyl-dimethylazanium.
| Compound Name | 3-[[(5R)-1-(4-ethoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 7367137 |
| Molecular Formula | C18H25N4O4+ |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 3-[[(5R)-1-(4-ethoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]propyl-dimethylazanium |
| SMILES | CCOc1ccc(N2C(=O)NC(=O)[C@@H](/C=N/CCC[NH+](C)C)C2=O)cc1 |
| InChI | InChI=1S/C18H24N4O4/c1-4-26-14-8-6-13(7-9-14)22-17(24)15(16(23)20-18(22)25)12-19-10-5-11-21(2)3/h6-9,12,15H,4-5,10-11H2,1-3H3,(H,20,23,25)/p+1/b19-12+/t15-/m1/s1 |
| InChIKey | LAZWEEGKYIFTRB-IYSPOMMRSA-O |
| XLogP | -0.11 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|