C22H26N3O3+ — CID 9312168
2-[[(4R)-2-(4-ethoxyphenyl)-1,3-dioxo-4H-isoquinolin-4-yl]methylideneamino]ethyl-dimethylazanium (PubChem CID 9312168) has the molecular formula C22H26N3O3+ and a molecular weight of 380.47 g/mol. Its IUPAC name is 2-[[(4R)-2-(4-ethoxyphenyl)-1,3-dioxo-4H-isoquinolin-4-yl]methylideneamino]ethyl-dimethylazanium.
| Compound Name | 2-[[(4R)-2-(4-ethoxyphenyl)-1,3-dioxo-4H-isoquinolin-4-yl]methylideneamino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 9312168 |
| Molecular Formula | C22H26N3O3+ |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 2-[[(4R)-2-(4-ethoxyphenyl)-1,3-dioxo-4H-isoquinolin-4-yl]methylideneamino]ethyl-dimethylazanium |
| SMILES | CCOc1ccc(N2C(=O)c3ccccc3[C@H](/C=N/CC[NH+](C)C)C2=O)cc1 |
| InChI | InChI=1S/C22H25N3O3/c1-4-28-17-11-9-16(10-12-17)25-21(26)19-8-6-5-7-18(19)20(22(25)27)15-23-13-14-24(2)3/h5-12,15,20H,4,13-14H2,1-3H3/p+1/b23-15+/t20-/m0/s1 |
| InChIKey | DNPBBYKROLGLTF-VRMLFSPKSA-O |
| XLogP | 1.57 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|